C21H35N3O5 — CID 143227695
methoxymethane;N-[3-(methoxymethyl)-4-morpholin-4-ylphenyl]-N-methyl-2-morpholin-4-ylacetamide (PubChem CID 143227695) has the molecular formula C21H35N3O5 and a molecular weight of 409.53 g/mol. Its IUPAC name is methoxymethane;N-[3-(methoxymethyl)-4-morpholin-4-ylphenyl]-N-methyl-2-morpholin-4-ylacetamide.
| Compound Name | methoxymethane;N-[3-(methoxymethyl)-4-morpholin-4-ylphenyl]-N-methyl-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 143227695 |
| Molecular Formula | C21H35N3O5 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | methoxymethane;N-[3-(methoxymethyl)-4-morpholin-4-ylphenyl]-N-methyl-2-morpholin-4-ylacetamide |
| SMILES | COC.COCc1cc(N(C)C(=O)CN2CCOCC2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C19H29N3O4.C2H6O/c1-20(19(23)14-21-5-9-25-10-6-21)17-3-4-18(16(13-17)15-24-2)22-7-11-26-12-8-22;1-3-2/h3-4,13H,5-12,14-15H2,1-2H3;1-2H3 |
| InChIKey | MWYKZZXTIUKXER-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 63.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|