C21H24N2O4S — CID 71029944
methyl 2-[5-[methyl-[(E)-3-thiophen-2-ylprop-2-enoyl]amino]-2-morpholin-4-ylphenyl]acetate (PubChem CID 71029944) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is methyl 2-[5-[methyl-[(E)-3-thiophen-2-ylprop-2-enoyl]amino]-2-morpholin-4-ylphenyl]acetate.
| Compound Name | methyl 2-[5-[methyl-[(E)-3-thiophen-2-ylprop-2-enoyl]amino]-2-morpholin-4-ylphenyl]acetate |
|---|---|
| PubChem CID | 71029944 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | methyl 2-[5-[methyl-[(E)-3-thiophen-2-ylprop-2-enoyl]amino]-2-morpholin-4-ylphenyl]acetate |
| SMILES | COC(=O)Cc1cc(N(C)C(=O)/C=C/c2cccs2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C21H24N2O4S/c1-22(20(24)8-6-18-4-3-13-28-18)17-5-7-19(23-9-11-27-12-10-23)16(14-17)15-21(25)26-2/h3-8,13-14H,9-12,15H2,1-2H3/b8-6+ |
| InChIKey | AXSZGDXQQNCZMN-SOFGYWHQSA-N |
| XLogP | 2.98 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|