About N-methyl-1-(2-methyl-5-nitrophenyl)methanimine;3-methylnonane
N-methyl-1-(2-methyl-5-nitrophenyl)methanimine;3-methylnonane (PubChem CID 143227876) has the molecular formula C19H32N2O2
and a molecular weight of 320.48 g/mol. Its IUPAC name is N-methyl-1-(2-methyl-5-nitrophenyl)methanimine;3-methylnonane.
Molecular Properties
| Compound Name | N-methyl-1-(2-methyl-5-nitrophenyl)methanimine;3-methylnonane |
| PubChem CID | 143227876 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | N-methyl-1-(2-methyl-5-nitrophenyl)methanimine;3-methylnonane |
| SMILES | C/N=C/c1cc([N+](=O)[O-])ccc1C.CCCCCCC(C)CC |
| InChI | InChI=1S/C10H22.C9H10N2O2/c1-4-6-7-8-9-10(3)5-2;1-7-3-4-9(11(12)13)5-8(7)6-10-2/h10H,4-9H2,1-3H3;3-6H,1-2H3/b;10-6+ |
| InChIKey | ZAVFNSUFEGWMPN-LOQGCFKBSA-N |
| XLogP | 5.95 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-(2-methyl-5-nitrophenyl)methanimine;3-methylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(2-methyl-5-nitrophenyl)methanimine;3-methylnonane?
The IUPAC name of N-methyl-1-(2-methyl-5-nitrophenyl)methanimine;3-methylnonane (CID 143227876) is N-methyl-1-(2-methyl-5-nitrophenyl)methanimine;3-methylnonane.
What is the SMILES notation for N-methyl-1-(2-methyl-5-nitrophenyl)methanimine;3-methylnonane?
The canonical SMILES for N-methyl-1-(2-methyl-5-nitrophenyl)methanimine;3-methylnonane is C/N=C/c1cc([N+](=O)[O-])ccc1C.CCCCCCC(C)CC.
What is the InChIKey of N-methyl-1-(2-methyl-5-nitrophenyl)methanimine;3-methylnonane?
The InChIKey is ZAVFNSUFEGWMPN-LOQGCFKBSA-N. The full InChI is InChI=1S/C10H22.C9H10N2O2/c1-4-6-7-8-9-10(3)5-2;1-7-3-4-9(11(12)13)5-8(7)6-10-2/h10H,4-9H2,1-3H3;3-6H,1-2H3/b;10-6+.
What are the key properties of N-methyl-1-(2-methyl-5-nitrophenyl)methanimine;3-methylnonane?
N-methyl-1-(2-methyl-5-nitrophenyl)methanimine;3-methylnonane has a molecular weight of 320.48 g/mol, XLogP of 5.95, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(2-methyl-5-nitrophenyl)methanimine;3-methylnonane is sourced from PubChem (CID 143227876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).