C26H40N6O3S — CID 143228029
1-[3-[4-amino-1-(5-aminopentyl)-2-(ethoxymethyl)imidazo[4,5-c]quinolin-7-yl]oxypropyl]pyrrolidin-2-one;methanethiol (PubChem CID 143228029) has the molecular formula C26H40N6O3S and a molecular weight of 516.71 g/mol. Its IUPAC name is 1-[3-[4-amino-1-(5-aminopentyl)-2-(ethoxymethyl)imidazo[4,5-c]quinolin-7-yl]oxypropyl]pyrrolidin-2-one;methanethiol.
| Compound Name | 1-[3-[4-amino-1-(5-aminopentyl)-2-(ethoxymethyl)imidazo[4,5-c]quinolin-7-yl]oxypropyl]pyrrolidin-2-one;methanethiol |
|---|---|
| PubChem CID | 143228029 |
| Molecular Formula | C26H40N6O3S |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | 1-[3-[4-amino-1-(5-aminopentyl)-2-(ethoxymethyl)imidazo[4,5-c]quinolin-7-yl]oxypropyl]pyrrolidin-2-one;methanethiol |
| SMILES | CCOCc1nc2c(N)nc3cc(OCCCN4CCCC4=O)ccc3c2n1CCCCCN.CS |
| InChI | InChI=1S/C25H36N6O3.CH4S/c1-2-33-17-21-29-23-24(31(21)14-5-3-4-11-26)19-10-9-18(16-20(19)28-25(23)27)34-15-7-13-30-12-6-8-22(30)32;1-2/h9-10,16H,2-8,11-15,17,26H2,1H3,(H2,27,28);2H,1H3 |
| InChIKey | VFIDDKSSGOQZHJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|