C31H35F2N3O4 — CID 143228907
(2S)-2-[[2-[[4-(cyclopropylmethyl)-2,6-dimethylanilino]methoxymethylamino]-4-(3,4-difluorophenyl)benzoyl]amino]butanoic acid (PubChem CID 143228907) has the molecular formula C31H35F2N3O4 and a molecular weight of 551.63 g/mol. Its IUPAC name is (2S)-2-[[2-[[4-(cyclopropylmethyl)-2,6-dimethylanilino]methoxymethylamino]-4-(3,4-difluorophenyl)benzoyl]amino]butanoic acid.
| Compound Name | (2S)-2-[[2-[[4-(cyclopropylmethyl)-2,6-dimethylanilino]methoxymethylamino]-4-(3,4-difluorophenyl)benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 143228907 |
| Molecular Formula | C31H35F2N3O4 |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | (2S)-2-[[2-[[4-(cyclopropylmethyl)-2,6-dimethylanilino]methoxymethylamino]-4-(3,4-difluorophenyl)benzoyl]amino]butanoic acid |
| SMILES | CC[C@H](NC(=O)c1ccc(-c2ccc(F)c(F)c2)cc1NCOCNc1c(C)cc(CC2CC2)cc1C)C(=O)O |
| InChI | InChI=1S/C31H35F2N3O4/c1-4-27(31(38)39)36-30(37)24-9-7-23(22-8-10-25(32)26(33)14-22)15-28(24)34-16-40-17-35-29-18(2)11-21(12-19(29)3)13-20-5-6-20/h7-12,14-15,20,27,34-35H,4-6,13,16-17H2,1-3H3,(H,36,37)(H,38,39)/t27-/m0/s1 |
| InChIKey | PIOVVIGSYWAVQW-MHZLTWQESA-N |
| XLogP | 6.25 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|