About N-phenylbutanamide
N-phenylbutanamide (PubChem CID 14323) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is N-phenylbutanamide.
Molecular Properties
| Compound Name | N-phenylbutanamide |
| PubChem CID | 14323 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | N-phenylbutanamide |
| SMILES | CCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C10H13NO/c1-2-6-10(12)11-9-7-4-3-5-8-9/h3-5,7-8H,2,6H2,1H3,(H,11,12) |
| InChIKey | UHANVDZCDNSILX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-phenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylbutanamide?
The IUPAC name of N-phenylbutanamide (CID 14323) is N-phenylbutanamide.
What is the SMILES notation for N-phenylbutanamide?
The canonical SMILES for N-phenylbutanamide is CCCC(=O)Nc1ccccc1.
What is the InChIKey of N-phenylbutanamide?
The InChIKey is UHANVDZCDNSILX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-2-6-10(12)11-9-7-4-3-5-8-9/h3-5,7-8H,2,6H2,1H3,(H,11,12).
What are the key properties of N-phenylbutanamide?
N-phenylbutanamide has a molecular weight of 163.22 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylbutanamide is sourced from PubChem (CID 14323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).