C9H10N2 — CID 143230392
2-(2H-pyrrol-2-yl)-2,3-dihydropyridine (PubChem CID 143230392) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-(2H-pyrrol-2-yl)-2,3-dihydropyridine.
| Compound Name | 2-(2H-pyrrol-2-yl)-2,3-dihydropyridine |
|---|---|
| PubChem CID | 143230392 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 2-(2H-pyrrol-2-yl)-2,3-dihydropyridine |
| SMILES | C1=CCC(C2C=CC=N2)N=C1 |
| InChI | InChI=1S/C9H10N2/c1-2-6-10-8(4-1)9-5-3-7-11-9/h1-3,5-9H,4H2 |
| InChIKey | LKFRSFIBHNPXIW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |