C17H20ClNO3 — CID 143232166
(Z)-but-2-ene;4-(5-chloro-1-methylindol-3-yl)-4-oxobutanoic acid (PubChem CID 143232166) has the molecular formula C17H20ClNO3 and a molecular weight of 321.80 g/mol. Its IUPAC name is (Z)-but-2-ene;4-(5-chloro-1-methylindol-3-yl)-4-oxobutanoic acid.
| Compound Name | (Z)-but-2-ene;4-(5-chloro-1-methylindol-3-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 143232166 |
| Molecular Formula | C17H20ClNO3 |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | (Z)-but-2-ene;4-(5-chloro-1-methylindol-3-yl)-4-oxobutanoic acid |
| SMILES | C/C=C\C.Cn1cc(C(=O)CCC(=O)O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C13H12ClNO3.C4H8/c1-15-7-10(12(16)4-5-13(17)18)9-6-8(14)2-3-11(9)15;1-3-4-2/h2-3,6-7H,4-5H2,1H3,(H,17,18);3-4H,1-2H3/b;4-3- |
| InChIKey | CSYVAWFKKIIWRW-QGAMPUOQSA-N |
| XLogP | 4.46 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|