C14H17ClN2O3 — CID 160716465
5-chloro-N-(2-hydroxypropan-2-yl)-1-methylindole-3-carboxamide;formaldehyde (PubChem CID 160716465) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is 5-chloro-N-(2-hydroxypropan-2-yl)-1-methylindole-3-carboxamide;formaldehyde.
| Compound Name | 5-chloro-N-(2-hydroxypropan-2-yl)-1-methylindole-3-carboxamide;formaldehyde |
|---|---|
| PubChem CID | 160716465 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 5-chloro-N-(2-hydroxypropan-2-yl)-1-methylindole-3-carboxamide;formaldehyde |
| SMILES | C=O.Cn1cc(C(=O)NC(C)(C)O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C13H15ClN2O2.CH2O/c1-13(2,18)15-12(17)10-7-16(3)11-5-4-8(14)6-9(10)11;1-2/h4-7,18H,1-3H3,(H,15,17);1H2 |
| InChIKey | RSNOSXXUQLRQIQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|