C25H31NO4 — CID 143232474
(4-cyclohexyloxyphenyl)-[(3S)-3-(2-methylphenyl)pyrrolidin-1-yl]methanone;formic acid (PubChem CID 143232474) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is (4-cyclohexyloxyphenyl)-[(3S)-3-(2-methylphenyl)pyrrolidin-1-yl]methanone;formic acid.
| Compound Name | (4-cyclohexyloxyphenyl)-[(3S)-3-(2-methylphenyl)pyrrolidin-1-yl]methanone;formic acid |
|---|---|
| PubChem CID | 143232474 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | (4-cyclohexyloxyphenyl)-[(3S)-3-(2-methylphenyl)pyrrolidin-1-yl]methanone;formic acid |
| SMILES | Cc1ccccc1[C@@H]1CCN(C(=O)c2ccc(OC3CCCCC3)cc2)C1.O=CO |
| InChI | InChI=1S/C24H29NO2.CH2O2/c1-18-7-5-6-10-23(18)20-15-16-25(17-20)24(26)19-11-13-22(14-12-19)27-21-8-3-2-4-9-21;2-1-3/h5-7,10-14,20-21H,2-4,8-9,15-17H2,1H3;1H,(H,2,3)/t20-;/m1./s1 |
| InChIKey | OPFHOEGJQSEQFQ-VEIFNGETSA-N |
| XLogP | 5.04 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|