C13H22N2 — CID 143232696
ethane;2-[(3E,6Z)-octa-1,3,6-trien-4-yl]-4,5-dihydro-1H-imidazole (PubChem CID 143232696) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is ethane;2-[(3E,6Z)-octa-1,3,6-trien-4-yl]-4,5-dihydro-1H-imidazole.
| Compound Name | ethane;2-[(3E,6Z)-octa-1,3,6-trien-4-yl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 143232696 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | ethane;2-[(3E,6Z)-octa-1,3,6-trien-4-yl]-4,5-dihydro-1H-imidazole |
| SMILES | C=C/C=C(\C/C=C\C)C1=NCCN1.CC |
| InChI | InChI=1S/C11H16N2.C2H6/c1-3-5-7-10(6-4-2)11-12-8-9-13-11;1-2/h3-6H,2,7-9H2,1H3,(H,12,13);1-2H3/b5-3-,10-6+; |
| InChIKey | ZOXXDHDKAGKXRX-IULRTABXSA-N |
| XLogP | 3.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|