C25H36N4O2 — CID 143233968
(3E,5E)-N-[2-(1-aminoethenyl)phenyl]-3-(piperidin-4-yloxymethyl)-5-pyrrolidin-1-ylhepta-3,5-dienamide (PubChem CID 143233968) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is (3E,5E)-N-[2-(1-aminoethenyl)phenyl]-3-(piperidin-4-yloxymethyl)-5-pyrrolidin-1-ylhepta-3,5-dienamide.
| Compound Name | (3E,5E)-N-[2-(1-aminoethenyl)phenyl]-3-(piperidin-4-yloxymethyl)-5-pyrrolidin-1-ylhepta-3,5-dienamide |
|---|---|
| PubChem CID | 143233968 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | (3E,5E)-N-[2-(1-aminoethenyl)phenyl]-3-(piperidin-4-yloxymethyl)-5-pyrrolidin-1-ylhepta-3,5-dienamide |
| SMILES | C=C(N)c1ccccc1NC(=O)C/C(=C\C(=C/C)N1CCCC1)COC1CCNCC1 |
| InChI | InChI=1S/C25H36N4O2/c1-3-21(29-14-6-7-15-29)16-20(18-31-22-10-12-27-13-11-22)17-25(30)28-24-9-5-4-8-23(24)19(2)26/h3-5,8-9,16,22,27H,2,6-7,10-15,17-18,26H2,1H3,(H,28,30)/b20-16+,21-3+ |
| InChIKey | SUBQZTQMKRHPIH-MGKMRYLJSA-N |
| XLogP | 3.64 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|