C24H23F3N2O3 — CID 143234157
1-[4-[[4-[[3-(diaminomethyl)phenyl]methyl]phenyl]methoxy]-2-hydroxy-3-(trifluoromethyl)phenyl]ethanone (PubChem CID 143234157) has the molecular formula C24H23F3N2O3 and a molecular weight of 444.45 g/mol. Its IUPAC name is 1-[4-[[4-[[3-(diaminomethyl)phenyl]methyl]phenyl]methoxy]-2-hydroxy-3-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-[4-[[4-[[3-(diaminomethyl)phenyl]methyl]phenyl]methoxy]-2-hydroxy-3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 143234157 |
| Molecular Formula | C24H23F3N2O3 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 1-[4-[[4-[[3-(diaminomethyl)phenyl]methyl]phenyl]methoxy]-2-hydroxy-3-(trifluoromethyl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCc2ccc(Cc3cccc(C(N)N)c3)cc2)c(C(F)(F)F)c1O |
| InChI | InChI=1S/C24H23F3N2O3/c1-14(30)19-9-10-20(21(22(19)31)24(25,26)27)32-13-16-7-5-15(6-8-16)11-17-3-2-4-18(12-17)23(28)29/h2-10,12,23,31H,11,13,28-29H2,1H3 |
| InChIKey | JIDDPSCHGKZZLL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|