C27H32N4O4 — CID 163601401
3-[[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenyl]-methoxymethyl]-N,N'-diaminobenzenecarboximidamide (PubChem CID 163601401) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is 3-[[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenyl]-methoxymethyl]-N,N'-diaminobenzenecarboximidamide.
| Compound Name | 3-[[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenyl]-methoxymethyl]-N,N'-diaminobenzenecarboximidamide |
|---|---|
| PubChem CID | 163601401 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 3-[[4-[(4-acetyl-3-hydroxy-2-propylphenoxy)methyl]phenyl]-methoxymethyl]-N,N'-diaminobenzenecarboximidamide |
| SMILES | CCCc1c(OCc2ccc(C(OC)c3cccc(C(=NN)NN)c3)cc2)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C27H32N4O4/c1-4-6-23-24(14-13-22(17(2)32)25(23)33)35-16-18-9-11-19(12-10-18)26(34-3)20-7-5-8-21(15-20)27(30-28)31-29/h5,7-15,26,33H,4,6,16,28-29H2,1-3H3,(H,30,31) |
| InChIKey | GXYSOXDPBIKISN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|