C18H17ClF3NO4 — CID 87458790
N-[[3-[[4-acetyl-3-hydroxy-2-(trifluoromethyl)phenoxy]methyl]phenyl]methyl]formamide;hydrochloride (PubChem CID 87458790) has the molecular formula C18H17ClF3NO4 and a molecular weight of 403.78 g/mol. Its IUPAC name is N-[[3-[[4-acetyl-3-hydroxy-2-(trifluoromethyl)phenoxy]methyl]phenyl]methyl]formamide;hydrochloride.
| Compound Name | N-[[3-[[4-acetyl-3-hydroxy-2-(trifluoromethyl)phenoxy]methyl]phenyl]methyl]formamide;hydrochloride |
|---|---|
| PubChem CID | 87458790 |
| Molecular Formula | C18H17ClF3NO4 |
| Molecular Weight | 403.78 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | N-[[3-[[4-acetyl-3-hydroxy-2-(trifluoromethyl)phenoxy]methyl]phenyl]methyl]formamide;hydrochloride |
| SMILES | CC(=O)c1ccc(OCc2cccc(CNC=O)c2)c(C(F)(F)F)c1O.Cl |
| InChI | InChI=1S/C18H16F3NO4.ClH/c1-11(24)14-5-6-15(16(17(14)25)18(19,20)21)26-9-13-4-2-3-12(7-13)8-22-10-23;/h2-7,10,25H,8-9H2,1H3,(H,22,23);1H |
| InChIKey | MHWGBULPTKAZAD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.78 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|