C12H20N2 — CID 143234347
1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine (PubChem CID 143234347) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine.
| Compound Name | 1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 143234347 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]prop-2-en-1-imine |
| SMILES | C=C/C(=N\C=C/C)N1CCC(C)CC1 |
| InChI | InChI=1S/C12H20N2/c1-4-8-13-12(5-2)14-9-6-11(3)7-10-14/h4-5,8,11H,2,6-7,9-10H2,1,3H3/b8-4-,13-12+ |
| InChIKey | DJNQBAVHSZGKRV-ZQGSCZMJSA-N |
| XLogP | 2.84 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|