C24H25NO3 — CID 143234395
2-(butanoylamino)benzoic acid;1-methyl-3-phenylbenzene (PubChem CID 143234395) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-(butanoylamino)benzoic acid;1-methyl-3-phenylbenzene.
| Compound Name | 2-(butanoylamino)benzoic acid;1-methyl-3-phenylbenzene |
|---|---|
| PubChem CID | 143234395 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-(butanoylamino)benzoic acid;1-methyl-3-phenylbenzene |
| SMILES | CCCC(=O)Nc1ccccc1C(=O)O.Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C13H12.C11H13NO3/c1-11-6-5-9-13(10-11)12-7-3-2-4-8-12;1-2-5-10(13)12-9-7-4-3-6-8(9)11(14)15/h2-10H,1H3;3-4,6-7H,2,5H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | NMTLPURPVCQTPG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |