C15H22N2O — CID 143234820
(2R)-2,5-dimethyl-N-(4-methylphenyl)piperidine-1-carboxamide (PubChem CID 143234820) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is (2R)-2,5-dimethyl-N-(4-methylphenyl)piperidine-1-carboxamide.
| Compound Name | (2R)-2,5-dimethyl-N-(4-methylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 143234820 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (2R)-2,5-dimethyl-N-(4-methylphenyl)piperidine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CC(C)CC[C@H]2C)cc1 |
| InChI | InChI=1S/C15H22N2O/c1-11-5-8-14(9-6-11)16-15(18)17-10-12(2)4-7-13(17)3/h5-6,8-9,12-13H,4,7,10H2,1-3H3,(H,16,18)/t12?,13-/m1/s1 |
| InChIKey | VKVPLPJTEYIONQ-ZGTCLIOFSA-N |
| XLogP | 3.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |