C22H23ClN6 — CID 143235813
2-[3-[1-(5-chloro-1H-pyrrolo[2,3-c]pyridin-2-yl)ethenylamino]-2-methylidene-3,4-dihydroquinolin-1-yl]-N'-methylethanimidamide (PubChem CID 143235813) has the molecular formula C22H23ClN6 and a molecular weight of 406.92 g/mol. Its IUPAC name is 2-[3-[1-(5-chloro-1H-pyrrolo[2,3-c]pyridin-2-yl)ethenylamino]-2-methylidene-3,4-dihydroquinolin-1-yl]-N'-methylethanimidamide.
| Compound Name | 2-[3-[1-(5-chloro-1H-pyrrolo[2,3-c]pyridin-2-yl)ethenylamino]-2-methylidene-3,4-dihydroquinolin-1-yl]-N'-methylethanimidamide |
|---|---|
| PubChem CID | 143235813 |
| Molecular Formula | C22H23ClN6 |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-[3-[1-(5-chloro-1H-pyrrolo[2,3-c]pyridin-2-yl)ethenylamino]-2-methylidene-3,4-dihydroquinolin-1-yl]-N'-methylethanimidamide |
| SMILES | C=C(NC1Cc2ccccc2N(C/C(N)=N/C)C1=C)c1cc2cc(Cl)ncc2[nH]1 |
| InChI | InChI=1S/C22H23ClN6/c1-13(17-9-16-10-21(23)26-11-19(16)28-17)27-18-8-15-6-4-5-7-20(15)29(14(18)2)12-22(24)25-3/h4-7,9-11,18,27-28H,1-2,8,12H2,3H3,(H2,24,25) |
| InChIKey | GHXVJHDRQLYDQD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|