C19H17ClN6O3 — CID 72994312
N-[1-(2-amino-2-hydroxyiminoethyl)-2-oxo-3,4-dihydroquinolin-3-yl]-5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 72994312) has the molecular formula C19H17ClN6O3 and a molecular weight of 412.84 g/mol. Its IUPAC name is N-[1-(2-amino-2-hydroxyiminoethyl)-2-oxo-3,4-dihydroquinolin-3-yl]-5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-[1-(2-amino-2-hydroxyiminoethyl)-2-oxo-3,4-dihydroquinolin-3-yl]-5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 72994312 |
| Molecular Formula | C19H17ClN6O3 |
| Molecular Weight | 412.84 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[1-(2-amino-2-hydroxyiminoethyl)-2-oxo-3,4-dihydroquinolin-3-yl]-5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | NC(CN1C(=O)C(NC(=O)c2cc3cc(Cl)ncc3[nH]2)Cc2ccccc21)=NO |
| InChI | InChI=1S/C19H17ClN6O3/c20-16-7-11-6-12(23-14(11)8-22-16)18(27)24-13-5-10-3-1-2-4-15(10)26(19(13)28)9-17(21)25-29/h1-4,6-8,13,23,29H,5,9H2,(H2,21,25)(H,24,27) |
| InChIKey | VCJQJZIQADQEJB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 136.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.84 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|