C23H24ClN3O3 — CID 143235852
5-chloro-N-[2-oxo-1-(oxolan-2-ylmethyl)-3,4-dihydroquinolin-3-yl]-5,6-dihydro-1H-indole-2-carboxamide (PubChem CID 143235852) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is 5-chloro-N-[2-oxo-1-(oxolan-2-ylmethyl)-3,4-dihydroquinolin-3-yl]-5,6-dihydro-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-[2-oxo-1-(oxolan-2-ylmethyl)-3,4-dihydroquinolin-3-yl]-5,6-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 143235852 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 5-chloro-N-[2-oxo-1-(oxolan-2-ylmethyl)-3,4-dihydroquinolin-3-yl]-5,6-dihydro-1H-indole-2-carboxamide |
| SMILES | O=C(NC1Cc2ccccc2N(CC2CCCO2)C1=O)c1cc2c([nH]1)=CCC(Cl)C=2 |
| InChI | InChI=1S/C23H24ClN3O3/c24-16-7-8-18-15(10-16)12-19(25-18)22(28)26-20-11-14-4-1-2-6-21(14)27(23(20)29)13-17-5-3-9-30-17/h1-2,4,6,8,10,12,16-17,20,25H,3,5,7,9,11,13H2,(H,26,28) |
| InChIKey | RWYYSIMDSVGWIF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|