C20H24FN3O3 — CID 124906961
8-fluoro-4-oxo-N-[1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]-1H-quinoline-2-carboxamide (PubChem CID 124906961) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is 8-fluoro-4-oxo-N-[1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]-1H-quinoline-2-carboxamide.
| Compound Name | 8-fluoro-4-oxo-N-[1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]-1H-quinoline-2-carboxamide |
|---|---|
| PubChem CID | 124906961 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 8-fluoro-4-oxo-N-[1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]-1H-quinoline-2-carboxamide |
| SMILES | O=C(NC1CCN(C[C@@H]2CCCO2)CC1)c1cc(=O)c2cccc(F)c2[nH]1 |
| InChI | InChI=1S/C20H24FN3O3/c21-16-5-1-4-15-18(25)11-17(23-19(15)16)20(26)22-13-6-8-24(9-7-13)12-14-3-2-10-27-14/h1,4-5,11,13-14H,2-3,6-10,12H2,(H,22,26)(H,23,25)/t14-/m0/s1 |
| InChIKey | KXQZGZXIWPIEIV-AWEZNQCLSA-N |
| XLogP | 2.04 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |