C18H23FN2O2 — CID 72933930
8-fluoro-2-[[4-(oxolan-2-yl)butylamino]methyl]-1H-quinolin-4-one (PubChem CID 72933930) has the molecular formula C18H23FN2O2 and a molecular weight of 318.39 g/mol. Its IUPAC name is 8-fluoro-2-[[4-(oxolan-2-yl)butylamino]methyl]-1H-quinolin-4-one.
| Compound Name | 8-fluoro-2-[[4-(oxolan-2-yl)butylamino]methyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 72933930 |
| Molecular Formula | C18H23FN2O2 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 8-fluoro-2-[[4-(oxolan-2-yl)butylamino]methyl]-1H-quinolin-4-one |
| SMILES | O=c1cc(CNCCCCC2CCCO2)[nH]c2c(F)cccc12 |
| InChI | InChI=1S/C18H23FN2O2/c19-16-8-3-7-15-17(22)11-13(21-18(15)16)12-20-9-2-1-5-14-6-4-10-23-14/h3,7-8,11,14,20H,1-2,4-6,9-10,12H2,(H,21,22) |
| InChIKey | DKGXZQUCCHFKEC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|