C18H30OS — CID 143236575
5,5,7,7-tetramethyloctylsulfinylbenzene (PubChem CID 143236575) has the molecular formula C18H30OS and a molecular weight of 294.50 g/mol. Its IUPAC name is 5,5,7,7-tetramethyloctylsulfinylbenzene.
| Compound Name | 5,5,7,7-tetramethyloctylsulfinylbenzene |
|---|---|
| PubChem CID | 143236575 |
| Molecular Formula | C18H30OS |
| Molecular Weight | 294.50 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 5,5,7,7-tetramethyloctylsulfinylbenzene |
| SMILES | CC(C)(C)CC(C)(C)CCCCS(=O)c1ccccc1 |
| InChI | InChI=1S/C18H30OS/c1-17(2,3)15-18(4,5)13-9-10-14-20(19)16-11-7-6-8-12-16/h6-8,11-12H,9-10,13-15H2,1-5H3 |
| InChIKey | HUQCBWVDUGRPPP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|