C26H33ClN4O4 — CID 143236671
N-[1-(3-amino-4-ethylcyclohepta-1,3,5-trien-1-yl)propyl]-6-[(5-chloro-2-methoxyphenyl)methyl]-3,7-dioxo-1,4-diazepane-1-carboxamide (PubChem CID 143236671) has the molecular formula C26H33ClN4O4 and a molecular weight of 501.03 g/mol. Its IUPAC name is N-[1-(3-amino-4-ethylcyclohepta-1,3,5-trien-1-yl)propyl]-6-[(5-chloro-2-methoxyphenyl)methyl]-3,7-dioxo-1,4-diazepane-1-carboxamide.
| Compound Name | N-[1-(3-amino-4-ethylcyclohepta-1,3,5-trien-1-yl)propyl]-6-[(5-chloro-2-methoxyphenyl)methyl]-3,7-dioxo-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 143236671 |
| Molecular Formula | C26H33ClN4O4 |
| Molecular Weight | 501.03 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | N-[1-(3-amino-4-ethylcyclohepta-1,3,5-trien-1-yl)propyl]-6-[(5-chloro-2-methoxyphenyl)methyl]-3,7-dioxo-1,4-diazepane-1-carboxamide |
| SMILES | CCC1=C(N)C=C(C(CC)NC(=O)N2CC(=O)NCC(Cc3cc(Cl)ccc3OC)C2=O)CC=C1 |
| InChI | InChI=1S/C26H33ClN4O4/c1-4-16-7-6-8-17(13-21(16)28)22(5-2)30-26(34)31-15-24(32)29-14-19(25(31)33)11-18-12-20(27)9-10-23(18)35-3/h6-7,9-10,12-13,19,22H,4-5,8,11,14-15,28H2,1-3H3,(H,29,32)(H,30,34) |
| InChIKey | JHGIWYYSBFUPEH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.03 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |