C25H30ClN5O6 — CID 163713307
2-amino-4-[(1R)-1-[[6-[(5-chloro-2-methoxyphenyl)methyl]-3-(methoxyamino)-7-oxo-5,6-dihydro-2H-1,4-diazepine-1-carbonyl]amino]propyl]benzoic acid (PubChem CID 163713307) has the molecular formula C25H30ClN5O6 and a molecular weight of 532.00 g/mol. Its IUPAC name is 2-amino-4-[(1R)-1-[[6-[(5-chloro-2-methoxyphenyl)methyl]-3-(methoxyamino)-7-oxo-5,6-dihydro-2H-1,4-diazepine-1-carbonyl]amino]propyl]benzoic acid.
| Compound Name | 2-amino-4-[(1R)-1-[[6-[(5-chloro-2-methoxyphenyl)methyl]-3-(methoxyamino)-7-oxo-5,6-dihydro-2H-1,4-diazepine-1-carbonyl]amino]propyl]benzoic acid |
|---|---|
| PubChem CID | 163713307 |
| Molecular Formula | C25H30ClN5O6 |
| Molecular Weight | 532.00 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 2-amino-4-[(1R)-1-[[6-[(5-chloro-2-methoxyphenyl)methyl]-3-(methoxyamino)-7-oxo-5,6-dihydro-2H-1,4-diazepine-1-carbonyl]amino]propyl]benzoic acid |
| SMILES | CC[C@@H](NC(=O)N1CC(NOC)=NCC(Cc2cc(Cl)ccc2OC)C1=O)c1ccc(C(=O)O)c(N)c1 |
| InChI | InChI=1S/C25H30ClN5O6/c1-4-20(14-5-7-18(24(33)34)19(27)11-14)29-25(35)31-13-22(30-37-3)28-12-16(23(31)32)9-15-10-17(26)6-8-21(15)36-2/h5-8,10-11,16,20H,4,9,12-13,27H2,1-3H3,(H,28,30)(H,29,35)(H,33,34)/t16?,20-/m1/s1 |
| InChIKey | KLDPDTAYQVNCIY-OTOKDRCRSA-N |
| XLogP | 3.04 |
| TPSA | 155.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.00 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|