C26H29ClF3N5O6 — CID 88994734
2-amino-4-[(1R)-1-[[(6R)-6-[(5-chloro-2-methoxyphenyl)methyl]-7-oxo-3-(2,2,2-trifluoroethoxyamino)-5,6-dihydro-2H-1,4-diazepine-1-carbonyl]amino]propyl]benzoic acid (PubChem CID 88994734) has the molecular formula C26H29ClF3N5O6 and a molecular weight of 599.99 g/mol. Its IUPAC name is 2-amino-4-[(1R)-1-[[(6R)-6-[(5-chloro-2-methoxyphenyl)methyl]-7-oxo-3-(2,2,2-trifluoroethoxyamino)-5,6-dihydro-2H-1,4-diazepine-1-carbonyl]amino]propyl]benzoic acid.
| Compound Name | 2-amino-4-[(1R)-1-[[(6R)-6-[(5-chloro-2-methoxyphenyl)methyl]-7-oxo-3-(2,2,2-trifluoroethoxyamino)-5,6-dihydro-2H-1,4-diazepine-1-carbonyl]amino]propyl]benzoic acid |
|---|---|
| PubChem CID | 88994734 |
| Molecular Formula | C26H29ClF3N5O6 |
| Molecular Weight | 599.99 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | 2-amino-4-[(1R)-1-[[(6R)-6-[(5-chloro-2-methoxyphenyl)methyl]-7-oxo-3-(2,2,2-trifluoroethoxyamino)-5,6-dihydro-2H-1,4-diazepine-1-carbonyl]amino]propyl]benzoic acid |
| SMILES | CC[C@@H](NC(=O)N1CC(NOCC(F)(F)F)=NC[C@@H](Cc2cc(Cl)ccc2OC)C1=O)c1ccc(C(=O)O)c(N)c1 |
| InChI | InChI=1S/C26H29ClF3N5O6/c1-3-20(14-4-6-18(24(37)38)19(31)10-14)33-25(39)35-12-22(34-41-13-26(28,29)30)32-11-16(23(35)36)8-15-9-17(27)5-7-21(15)40-2/h4-7,9-10,16,20H,3,8,11-13,31H2,1-2H3,(H,32,34)(H,33,39)(H,37,38)/t16-,20-/m1/s1 |
| InChIKey | WSNPHFQHPGDWOX-OXQOHEQNSA-N |
| XLogP | 3.97 |
| TPSA | 155.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.99 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|