C28H35ClN4O6 — CID 160627958
2-amino-4-[(3S)-1-[6-[(5-chloro-2-methoxyphenyl)methyl]-7-oxo-3-(1,1,2,2,2-pentadeuterioethoxyamino)-5,6-dihydro-2H-1,4-diazepin-1-yl]-1-oxohexan-3-yl]benzoic acid (PubChem CID 160627958) has the molecular formula C28H35ClN4O6 and a molecular weight of 564.09 g/mol. Its IUPAC name is 2-amino-4-[(3S)-1-[6-[(5-chloro-2-methoxyphenyl)methyl]-7-oxo-3-(1,1,2,2,2-pentadeuterioethoxyamino)-5,6-dihydro-2H-1,4-diazepin-1-yl]-1-oxohexan-3-yl]benzoic acid.
| Compound Name | 2-amino-4-[(3S)-1-[6-[(5-chloro-2-methoxyphenyl)methyl]-7-oxo-3-(1,1,2,2,2-pentadeuterioethoxyamino)-5,6-dihydro-2H-1,4-diazepin-1-yl]-1-oxohexan-3-yl]benzoic acid |
|---|---|
| PubChem CID | 160627958 |
| Molecular Formula | C28H35ClN4O6 |
| Molecular Weight | 564.09 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | 2-amino-4-[(3S)-1-[6-[(5-chloro-2-methoxyphenyl)methyl]-7-oxo-3-(1,1,2,2,2-pentadeuterioethoxyamino)-5,6-dihydro-2H-1,4-diazepin-1-yl]-1-oxohexan-3-yl]benzoic acid |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])ONC1=NCC(Cc2cc(Cl)ccc2OC)C(=O)N(C(=O)C[C@H](CCC)c2ccc(C(=O)O)c(N)c2)C1 |
| InChI | InChI=1S/C28H35ClN4O6/c1-4-6-17(18-7-9-22(28(36)37)23(30)13-18)14-26(34)33-16-25(32-39-5-2)31-15-20(27(33)35)11-19-12-21(29)8-10-24(19)38-3/h7-10,12-13,17,20H,4-6,11,14-16,30H2,1-3H3,(H,31,32)(H,36,37)/t17-,20?/m0/s1/i2D3,5D2 |
| InChIKey | RHOAGKQEVYYEJA-CSEFBMFESA-N |
| XLogP | 4.07 |
| TPSA | 143.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.09 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|