C29H37ClN4O5 — CID 172942224
2-amino-4-[(3S)-1-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-6-(dimethylhydrazinylidene)-2-oxoazepan-1-yl]-1-oxohexan-3-yl]benzoic acid (PubChem CID 172942224) has the molecular formula C29H37ClN4O5 and a molecular weight of 557.09 g/mol. Its IUPAC name is 2-amino-4-[(3S)-1-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-6-(dimethylhydrazinylidene)-2-oxoazepan-1-yl]-1-oxohexan-3-yl]benzoic acid.
| Compound Name | 2-amino-4-[(3S)-1-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-6-(dimethylhydrazinylidene)-2-oxoazepan-1-yl]-1-oxohexan-3-yl]benzoic acid |
|---|---|
| PubChem CID | 172942224 |
| Molecular Formula | C29H37ClN4O5 |
| Molecular Weight | 557.09 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | 2-amino-4-[(3S)-1-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-6-(dimethylhydrazinylidene)-2-oxoazepan-1-yl]-1-oxohexan-3-yl]benzoic acid |
| SMILES | CCC[C@@H](CC(=O)N1C/C(=N/N(C)C)CCC(Cc2cc(Cl)ccc2OC)C1=O)c1ccc(C(=O)O)c(N)c1 |
| InChI | InChI=1S/C29H37ClN4O5/c1-5-6-18(19-8-11-24(29(37)38)25(31)15-19)16-27(35)34-17-23(32-33(2)3)10-7-20(28(34)36)13-21-14-22(30)9-12-26(21)39-4/h8-9,11-12,14-15,18,20H,5-7,10,13,16-17,31H2,1-4H3,(H,37,38)/b32-23+/t18-,20?/m0/s1 |
| InChIKey | RMTIIQPKNPZRSY-NOJQPECUSA-N |
| XLogP | 4.83 |
| TPSA | 125.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.09 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|