C32H32ClFN2O6 — CID 172988683
4-[(3S)-1-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-6-(3-fluorophenoxy)imino-2-oxoazepan-1-yl]-1-oxopentan-3-yl]benzoic acid (PubChem CID 172988683) has the molecular formula C32H32ClFN2O6 and a molecular weight of 595.07 g/mol. Its IUPAC name is 4-[(3S)-1-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-6-(3-fluorophenoxy)imino-2-oxoazepan-1-yl]-1-oxopentan-3-yl]benzoic acid.
| Compound Name | 4-[(3S)-1-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-6-(3-fluorophenoxy)imino-2-oxoazepan-1-yl]-1-oxopentan-3-yl]benzoic acid |
|---|---|
| PubChem CID | 172988683 |
| Molecular Formula | C32H32ClFN2O6 |
| Molecular Weight | 595.07 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | 4-[(3S)-1-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-6-(3-fluorophenoxy)imino-2-oxoazepan-1-yl]-1-oxopentan-3-yl]benzoic acid |
| SMILES | CC[C@@H](CC(=O)N1C/C(=N/Oc2cccc(F)c2)CCC(Cc2cc(Cl)ccc2OC)C1=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C32H32ClFN2O6/c1-3-20(21-7-9-22(10-8-21)32(39)40)17-30(37)36-19-27(35-42-28-6-4-5-26(34)18-28)13-11-23(31(36)38)15-24-16-25(33)12-14-29(24)41-2/h4-10,12,14,16,18,20,23H,3,11,13,15,17,19H2,1-2H3,(H,39,40)/b35-27+/t20-,23?/m0/s1 |
| InChIKey | SYLKVYQWNIWYMH-DVIRDROYSA-N |
| XLogP | 6.51 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.07 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|