C32H31ClF2N2O6 — CID 172963020
2-[4-[(2S)-4-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-6-(3,5-difluorophenoxy)imino-2-oxoazepan-1-yl]-4-oxobutan-2-yl]phenyl]acetic acid (PubChem CID 172963020) has the molecular formula C32H31ClF2N2O6 and a molecular weight of 613.06 g/mol. Its IUPAC name is 2-[4-[(2S)-4-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-6-(3,5-difluorophenoxy)imino-2-oxoazepan-1-yl]-4-oxobutan-2-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[(2S)-4-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-6-(3,5-difluorophenoxy)imino-2-oxoazepan-1-yl]-4-oxobutan-2-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 172963020 |
| Molecular Formula | C32H31ClF2N2O6 |
| Molecular Weight | 613.06 g/mol |
| Exact Mass | 612.18 |
| IUPAC Name | 2-[4-[(2S)-4-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-6-(3,5-difluorophenoxy)imino-2-oxoazepan-1-yl]-4-oxobutan-2-yl]phenyl]acetic acid |
| SMILES | COc1ccc(Cl)cc1CC1CC/C(=N\Oc2cc(F)cc(F)c2)CN(C(=O)C[C@H](C)c2ccc(CC(=O)O)cc2)C1=O |
| InChI | InChI=1S/C32H31ClF2N2O6/c1-19(21-5-3-20(4-6-21)12-31(39)40)11-30(38)37-18-27(36-43-28-16-25(34)15-26(35)17-28)9-7-22(32(37)41)13-23-14-24(33)8-10-29(23)42-2/h3-6,8,10,14-17,19,22H,7,9,11-13,18H2,1-2H3,(H,39,40)/b36-27+/t19-,22?/m0/s1 |
| InChIKey | ASRQWCRKPBIBCR-JPCGFANLSA-N |
| XLogP | 6.19 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.06 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|