C26H25ClN2O6 — CID 58339215
3-[(5-chloro-2-methoxyphenyl)methyl]-1-[2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]acetyl]azepane-2,6-dione (PubChem CID 58339215) has the molecular formula C26H25ClN2O6 and a molecular weight of 496.95 g/mol. Its IUPAC name is 3-[(5-chloro-2-methoxyphenyl)methyl]-1-[2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]acetyl]azepane-2,6-dione.
| Compound Name | 3-[(5-chloro-2-methoxyphenyl)methyl]-1-[2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]acetyl]azepane-2,6-dione |
|---|---|
| PubChem CID | 58339215 |
| Molecular Formula | C26H25ClN2O6 |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 3-[(5-chloro-2-methoxyphenyl)methyl]-1-[2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]acetyl]azepane-2,6-dione |
| SMILES | COc1ccc(Cl)cc1CC1CCC(=O)CN(C(=O)C[C@H]2CC(=O)N(c3ccccc3)C2=O)C1=O |
| InChI | InChI=1S/C26H25ClN2O6/c1-35-22-10-8-19(27)12-17(22)11-16-7-9-21(30)15-28(25(16)33)23(31)13-18-14-24(32)29(26(18)34)20-5-3-2-4-6-20/h2-6,8,10,12,16,18H,7,9,11,13-15H2,1H3/t16?,18-/m0/s1 |
| InChIKey | RRMIBKTWEHPYIU-DAFXYXGESA-N |
| XLogP | 3.20 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|