C20H20Cl2N2O5S — CID 58339278
1-(3-amino-4-chlorophenyl)sulfonyl-3-[(5-chloro-2-methoxyphenyl)methyl]azepane-2,6-dione (PubChem CID 58339278) has the molecular formula C20H20Cl2N2O5S and a molecular weight of 471.36 g/mol. Its IUPAC name is 1-(3-amino-4-chlorophenyl)sulfonyl-3-[(5-chloro-2-methoxyphenyl)methyl]azepane-2,6-dione.
| Compound Name | 1-(3-amino-4-chlorophenyl)sulfonyl-3-[(5-chloro-2-methoxyphenyl)methyl]azepane-2,6-dione |
|---|---|
| PubChem CID | 58339278 |
| Molecular Formula | C20H20Cl2N2O5S |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 1-(3-amino-4-chlorophenyl)sulfonyl-3-[(5-chloro-2-methoxyphenyl)methyl]azepane-2,6-dione |
| SMILES | COc1ccc(Cl)cc1CC1CCC(=O)CN(S(=O)(=O)c2ccc(Cl)c(N)c2)C1=O |
| InChI | InChI=1S/C20H20Cl2N2O5S/c1-29-19-7-3-14(21)9-13(19)8-12-2-4-15(25)11-24(20(12)26)30(27,28)16-5-6-17(22)18(23)10-16/h3,5-7,9-10,12H,2,4,8,11,23H2,1H3 |
| InChIKey | BLHXXTSFKOLDRQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|