C23H20ClNO4S — CID 58339163
1-(4-chlorophenyl)sulfonyl-3-(naphthalen-2-ylmethyl)azepane-2,6-dione (PubChem CID 58339163) has the molecular formula C23H20ClNO4S and a molecular weight of 441.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-3-(naphthalen-2-ylmethyl)azepane-2,6-dione.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-3-(naphthalen-2-ylmethyl)azepane-2,6-dione |
|---|---|
| PubChem CID | 58339163 |
| Molecular Formula | C23H20ClNO4S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-3-(naphthalen-2-ylmethyl)azepane-2,6-dione |
| SMILES | O=C1CCC(Cc2ccc3ccccc3c2)C(=O)N(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C23H20ClNO4S/c24-20-8-11-22(12-9-20)30(28,29)25-15-21(26)10-7-19(23(25)27)14-16-5-6-17-3-1-2-4-18(17)13-16/h1-6,8-9,11-13,19H,7,10,14-15H2 |
| InChIKey | OHMCYSISTBWUNK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |