C22H24ClNO6S — CID 58339367
1-(4-chlorophenyl)sulfonyl-3-[[2-(methoxymethoxy)-5-methylphenyl]methyl]azepane-2,6-dione (PubChem CID 58339367) has the molecular formula C22H24ClNO6S and a molecular weight of 465.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-3-[[2-(methoxymethoxy)-5-methylphenyl]methyl]azepane-2,6-dione.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-3-[[2-(methoxymethoxy)-5-methylphenyl]methyl]azepane-2,6-dione |
|---|---|
| PubChem CID | 58339367 |
| Molecular Formula | C22H24ClNO6S |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-3-[[2-(methoxymethoxy)-5-methylphenyl]methyl]azepane-2,6-dione |
| SMILES | COCOc1ccc(C)cc1CC1CCC(=O)CN(S(=O)(=O)c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C22H24ClNO6S/c1-15-3-10-21(30-14-29-2)17(11-15)12-16-4-7-19(25)13-24(22(16)26)31(27,28)20-8-5-18(23)6-9-20/h3,5-6,8-11,16H,4,7,12-14H2,1-2H3 |
| InChIKey | AOWKJNJYWAYCTK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|