C19H16Cl3NO4S — CID 58339381
1-(4-chlorophenyl)sulfonyl-3-[(3,5-dichlorophenyl)methyl]azepane-2,6-dione (PubChem CID 58339381) has the molecular formula C19H16Cl3NO4S and a molecular weight of 460.77 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-3-[(3,5-dichlorophenyl)methyl]azepane-2,6-dione.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-3-[(3,5-dichlorophenyl)methyl]azepane-2,6-dione |
|---|---|
| PubChem CID | 58339381 |
| Molecular Formula | C19H16Cl3NO4S |
| Molecular Weight | 460.77 g/mol |
| Exact Mass | 458.99 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-3-[(3,5-dichlorophenyl)methyl]azepane-2,6-dione |
| SMILES | O=C1CCC(Cc2cc(Cl)cc(Cl)c2)C(=O)N(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H16Cl3NO4S/c20-14-2-5-18(6-3-14)28(26,27)23-11-17(24)4-1-13(19(23)25)7-12-8-15(21)10-16(22)9-12/h2-3,5-6,8-10,13H,1,4,7,11H2 |
| InChIKey | GTHFQLCIGXVDAQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.77 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |