C24H28ClN5O6S — CID 67969005
4-[4-amino-3-(piperazine-1-carbonyl)phenyl]sulfonyl-6-[(5-chloro-2-methoxyphenyl)methyl]-1,4-diazepane-2,5-dione (PubChem CID 67969005) has the molecular formula C24H28ClN5O6S and a molecular weight of 550.04 g/mol. Its IUPAC name is 4-[4-amino-3-(piperazine-1-carbonyl)phenyl]sulfonyl-6-[(5-chloro-2-methoxyphenyl)methyl]-1,4-diazepane-2,5-dione.
| Compound Name | 4-[4-amino-3-(piperazine-1-carbonyl)phenyl]sulfonyl-6-[(5-chloro-2-methoxyphenyl)methyl]-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 67969005 |
| Molecular Formula | C24H28ClN5O6S |
| Molecular Weight | 550.04 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | 4-[4-amino-3-(piperazine-1-carbonyl)phenyl]sulfonyl-6-[(5-chloro-2-methoxyphenyl)methyl]-1,4-diazepane-2,5-dione |
| SMILES | COc1ccc(Cl)cc1CC1CNC(=O)CN(S(=O)(=O)c2ccc(N)c(C(=O)N3CCNCC3)c2)C1=O |
| InChI | InChI=1S/C24H28ClN5O6S/c1-36-21-5-2-17(25)11-15(21)10-16-13-28-22(31)14-30(23(16)32)37(34,35)18-3-4-20(26)19(12-18)24(33)29-8-6-27-7-9-29/h2-5,11-12,16,27H,6-10,13-14,26H2,1H3,(H,28,31) |
| InChIKey | WGAPLMVVMHPTIU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 151.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.04 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|