C25H28ClN3O6 — CID 58339170
2-amino-4-[(3S)-1-[6-[(5-chloro-2-methoxyphenyl)methyl]-3,7-dioxo-1,4-diazepan-1-yl]-1-oxopentan-3-yl]benzoic acid (PubChem CID 58339170) has the molecular formula C25H28ClN3O6 and a molecular weight of 501.97 g/mol. Its IUPAC name is 2-amino-4-[(3S)-1-[6-[(5-chloro-2-methoxyphenyl)methyl]-3,7-dioxo-1,4-diazepan-1-yl]-1-oxopentan-3-yl]benzoic acid.
| Compound Name | 2-amino-4-[(3S)-1-[6-[(5-chloro-2-methoxyphenyl)methyl]-3,7-dioxo-1,4-diazepan-1-yl]-1-oxopentan-3-yl]benzoic acid |
|---|---|
| PubChem CID | 58339170 |
| Molecular Formula | C25H28ClN3O6 |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 2-amino-4-[(3S)-1-[6-[(5-chloro-2-methoxyphenyl)methyl]-3,7-dioxo-1,4-diazepan-1-yl]-1-oxopentan-3-yl]benzoic acid |
| SMILES | CC[C@@H](CC(=O)N1CC(=O)NCC(Cc2cc(Cl)ccc2OC)C1=O)c1ccc(C(=O)O)c(N)c1 |
| InChI | InChI=1S/C25H28ClN3O6/c1-3-14(15-4-6-19(25(33)34)20(27)10-15)11-23(31)29-13-22(30)28-12-17(24(29)32)8-16-9-18(26)5-7-21(16)35-2/h4-7,9-10,14,17H,3,8,11-13,27H2,1-2H3,(H,28,30)(H,33,34)/t14-,17?/m0/s1 |
| InChIKey | ARJLNVZIIPKOIE-MBIQTGHCSA-N |
| XLogP | 2.86 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|