C27H30ClN5O5 — CID 148982535
2-amino-4-[(3S)-1-[6-[(5-chloro-2-methoxyphenyl)methyl]-3-methyl-7-oxo-6,9-dihydro-5H-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]-1-oxopentan-3-yl]benzoic acid (PubChem CID 148982535) has the molecular formula C27H30ClN5O5 and a molecular weight of 540.02 g/mol. Its IUPAC name is 2-amino-4-[(3S)-1-[6-[(5-chloro-2-methoxyphenyl)methyl]-3-methyl-7-oxo-6,9-dihydro-5H-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]-1-oxopentan-3-yl]benzoic acid.
| Compound Name | 2-amino-4-[(3S)-1-[6-[(5-chloro-2-methoxyphenyl)methyl]-3-methyl-7-oxo-6,9-dihydro-5H-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]-1-oxopentan-3-yl]benzoic acid |
|---|---|
| PubChem CID | 148982535 |
| Molecular Formula | C27H30ClN5O5 |
| Molecular Weight | 540.02 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | 2-amino-4-[(3S)-1-[6-[(5-chloro-2-methoxyphenyl)methyl]-3-methyl-7-oxo-6,9-dihydro-5H-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]-1-oxopentan-3-yl]benzoic acid |
| SMILES | CCC(CC(=O)N1Cc2nnc(C)n2CC(Cc2cc(Cl)ccc2OC)C1=O)c1ccc(C(=O)O)c(N)c1 |
| InChI | InChI=1S/C27H30ClN5O5/c1-4-16(17-5-7-21(27(36)37)22(29)11-17)12-25(34)33-14-24-31-30-15(2)32(24)13-19(26(33)35)9-18-10-20(28)6-8-23(18)38-3/h5-8,10-11,16,19H,4,9,12-14,29H2,1-3H3,(H,36,37) |
| InChIKey | PWACPYGAMIEDCR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.02 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|