C28H34F2N4O6 — CID 160772847
2-amino-4-[(3S)-1-[6-[(4,5-difluoro-2-methoxyphenyl)methyl]-3-(ethoxyamino)-7-oxo-5,6-dihydro-2H-1,4-diazepin-1-yl]-1-oxohexan-3-yl]benzoic acid (PubChem CID 160772847) has the molecular formula C28H34F2N4O6 and a molecular weight of 560.60 g/mol. Its IUPAC name is 2-amino-4-[(3S)-1-[6-[(4,5-difluoro-2-methoxyphenyl)methyl]-3-(ethoxyamino)-7-oxo-5,6-dihydro-2H-1,4-diazepin-1-yl]-1-oxohexan-3-yl]benzoic acid.
| Compound Name | 2-amino-4-[(3S)-1-[6-[(4,5-difluoro-2-methoxyphenyl)methyl]-3-(ethoxyamino)-7-oxo-5,6-dihydro-2H-1,4-diazepin-1-yl]-1-oxohexan-3-yl]benzoic acid |
|---|---|
| PubChem CID | 160772847 |
| Molecular Formula | C28H34F2N4O6 |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | 2-amino-4-[(3S)-1-[6-[(4,5-difluoro-2-methoxyphenyl)methyl]-3-(ethoxyamino)-7-oxo-5,6-dihydro-2H-1,4-diazepin-1-yl]-1-oxohexan-3-yl]benzoic acid |
| SMILES | CCC[C@@H](CC(=O)N1CC(NOCC)=NCC(Cc2cc(F)c(F)cc2OC)C1=O)c1ccc(C(=O)O)c(N)c1 |
| InChI | InChI=1S/C28H34F2N4O6/c1-4-6-16(17-7-8-20(28(37)38)23(31)11-17)12-26(35)34-15-25(33-40-5-2)32-14-19(27(34)36)9-18-10-21(29)22(30)13-24(18)39-3/h7-8,10-11,13,16,19H,4-6,9,12,14-15,31H2,1-3H3,(H,32,33)(H,37,38)/t16-,19?/m0/s1 |
| InChIKey | RZNYIOIZEXAINZ-UCFFOFKASA-N |
| XLogP | 3.69 |
| TPSA | 143.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|