C31H30ClF3N4O5 — CID 162015668
2-amino-4-[(3S)-1-[6-[(5-chloro-2-fluorophenyl)methyl]-3-[(3,5-difluorophenoxy)amino]-7-oxo-5,6-dihydro-2H-1,4-diazepin-1-yl]-1-oxohexan-3-yl]benzoic acid (PubChem CID 162015668) has the molecular formula C31H30ClF3N4O5 and a molecular weight of 631.05 g/mol. Its IUPAC name is 2-amino-4-[(3S)-1-[6-[(5-chloro-2-fluorophenyl)methyl]-3-[(3,5-difluorophenoxy)amino]-7-oxo-5,6-dihydro-2H-1,4-diazepin-1-yl]-1-oxohexan-3-yl]benzoic acid.
| Compound Name | 2-amino-4-[(3S)-1-[6-[(5-chloro-2-fluorophenyl)methyl]-3-[(3,5-difluorophenoxy)amino]-7-oxo-5,6-dihydro-2H-1,4-diazepin-1-yl]-1-oxohexan-3-yl]benzoic acid |
|---|---|
| PubChem CID | 162015668 |
| Molecular Formula | C31H30ClF3N4O5 |
| Molecular Weight | 631.05 g/mol |
| Exact Mass | 630.19 |
| IUPAC Name | 2-amino-4-[(3S)-1-[6-[(5-chloro-2-fluorophenyl)methyl]-3-[(3,5-difluorophenoxy)amino]-7-oxo-5,6-dihydro-2H-1,4-diazepin-1-yl]-1-oxohexan-3-yl]benzoic acid |
| SMILES | CCC[C@@H](CC(=O)N1CC(NOc2cc(F)cc(F)c2)=NCC(Cc2cc(Cl)ccc2F)C1=O)c1ccc(C(=O)O)c(N)c1 |
| InChI | InChI=1S/C31H30ClF3N4O5/c1-2-3-17(18-4-6-25(31(42)43)27(36)10-18)11-29(40)39-16-28(38-44-24-13-22(33)12-23(34)14-24)37-15-20(30(39)41)8-19-9-21(32)5-7-26(19)35/h4-7,9-10,12-14,17,20H,2-3,8,11,15-16,36H2,1H3,(H,37,38)(H,42,43)/t17-,20?/m0/s1 |
| InChIKey | YUBNQRBUFJZAFZ-DIMJTDRSSA-N |
| XLogP | 5.52 |
| TPSA | 134.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.05 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|