C29H35ClN2O6 — CID 172944086
3-[(3S)-1-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-2-oxo-6-propoxyiminoazepan-1-yl]-1-oxopentan-3-yl]benzoic acid (PubChem CID 172944086) has the molecular formula C29H35ClN2O6 and a molecular weight of 543.06 g/mol. Its IUPAC name is 3-[(3S)-1-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-2-oxo-6-propoxyiminoazepan-1-yl]-1-oxopentan-3-yl]benzoic acid.
| Compound Name | 3-[(3S)-1-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-2-oxo-6-propoxyiminoazepan-1-yl]-1-oxopentan-3-yl]benzoic acid |
|---|---|
| PubChem CID | 172944086 |
| Molecular Formula | C29H35ClN2O6 |
| Molecular Weight | 543.06 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 3-[(3S)-1-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-2-oxo-6-propoxyiminoazepan-1-yl]-1-oxopentan-3-yl]benzoic acid |
| SMILES | CCCO/N=C1\CCC(Cc2cc(Cl)ccc2OC)C(=O)N(C(=O)C[C@H](CC)c2cccc(C(=O)O)c2)C1 |
| InChI | InChI=1S/C29H35ClN2O6/c1-4-13-38-31-25-11-9-21(15-23-16-24(30)10-12-26(23)37-3)28(34)32(18-25)27(33)17-19(5-2)20-7-6-8-22(14-20)29(35)36/h6-8,10,12,14,16,19,21H,4-5,9,11,13,15,17-18H2,1-3H3,(H,35,36)/b31-25+/t19-,21?/m0/s1 |
| InChIKey | DXDKSTFDSRUMMU-XDBHJONDSA-N |
| XLogP | 5.72 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.06 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|