C20H16Cl2N2O7S — CID 66935562
2-chloro-5-[[6-[(5-chloro-2-methoxyphenyl)methylidene]-3,7-dioxo-1,4-diazepan-1-yl]sulfonyl]benzoic acid (PubChem CID 66935562) has the molecular formula C20H16Cl2N2O7S and a molecular weight of 499.33 g/mol. Its IUPAC name is 2-chloro-5-[[6-[(5-chloro-2-methoxyphenyl)methylidene]-3,7-dioxo-1,4-diazepan-1-yl]sulfonyl]benzoic acid.
| Compound Name | 2-chloro-5-[[6-[(5-chloro-2-methoxyphenyl)methylidene]-3,7-dioxo-1,4-diazepan-1-yl]sulfonyl]benzoic acid |
|---|---|
| PubChem CID | 66935562 |
| Molecular Formula | C20H16Cl2N2O7S |
| Molecular Weight | 499.33 g/mol |
| Exact Mass | 498.01 |
| IUPAC Name | 2-chloro-5-[[6-[(5-chloro-2-methoxyphenyl)methylidene]-3,7-dioxo-1,4-diazepan-1-yl]sulfonyl]benzoic acid |
| SMILES | COc1ccc(Cl)cc1C=C1CNC(=O)CN(S(=O)(=O)c2ccc(Cl)c(C(=O)O)c2)C1=O |
| InChI | InChI=1S/C20H16Cl2N2O7S/c1-31-17-5-2-13(21)7-11(17)6-12-9-23-18(25)10-24(19(12)26)32(29,30)14-3-4-16(22)15(8-14)20(27)28/h2-8H,9-10H2,1H3,(H,23,25)(H,27,28) |
| InChIKey | CGPRLBVPUYLWAV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|