C17H19FN2O7S — CID 66935035
methyl 3-[[6-[(5-fluoro-2-methoxyphenyl)methylidene]-3,7-dioxo-1,4-diazepan-1-yl]sulfonyl]propanoate (PubChem CID 66935035) has the molecular formula C17H19FN2O7S and a molecular weight of 414.41 g/mol. Its IUPAC name is methyl 3-[[6-[(5-fluoro-2-methoxyphenyl)methylidene]-3,7-dioxo-1,4-diazepan-1-yl]sulfonyl]propanoate.
| Compound Name | methyl 3-[[6-[(5-fluoro-2-methoxyphenyl)methylidene]-3,7-dioxo-1,4-diazepan-1-yl]sulfonyl]propanoate |
|---|---|
| PubChem CID | 66935035 |
| Molecular Formula | C17H19FN2O7S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | methyl 3-[[6-[(5-fluoro-2-methoxyphenyl)methylidene]-3,7-dioxo-1,4-diazepan-1-yl]sulfonyl]propanoate |
| SMILES | COC(=O)CCS(=O)(=O)N1CC(=O)NCC(=Cc2cc(F)ccc2OC)C1=O |
| InChI | InChI=1S/C17H19FN2O7S/c1-26-14-4-3-13(18)8-11(14)7-12-9-19-15(21)10-20(17(12)23)28(24,25)6-5-16(22)27-2/h3-4,7-8H,5-6,9-10H2,1-2H3,(H,19,21) |
| InChIKey | UKHSFIMFCHRQHW-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|