C21H21ClN2O6S — CID 66934914
6-[(5-chloro-2-methoxyphenyl)methylidene]-4-(2-methoxy-5-methylphenyl)sulfonyl-1,4-diazepane-2,5-dione (PubChem CID 66934914) has the molecular formula C21H21ClN2O6S and a molecular weight of 464.93 g/mol. Its IUPAC name is 6-[(5-chloro-2-methoxyphenyl)methylidene]-4-(2-methoxy-5-methylphenyl)sulfonyl-1,4-diazepane-2,5-dione.
| Compound Name | 6-[(5-chloro-2-methoxyphenyl)methylidene]-4-(2-methoxy-5-methylphenyl)sulfonyl-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 66934914 |
| Molecular Formula | C21H21ClN2O6S |
| Molecular Weight | 464.93 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 6-[(5-chloro-2-methoxyphenyl)methylidene]-4-(2-methoxy-5-methylphenyl)sulfonyl-1,4-diazepane-2,5-dione |
| SMILES | COc1ccc(Cl)cc1C=C1CNC(=O)CN(S(=O)(=O)c2cc(C)ccc2OC)C1=O |
| InChI | InChI=1S/C21H21ClN2O6S/c1-13-4-6-18(30-3)19(8-13)31(27,28)24-12-20(25)23-11-15(21(24)26)9-14-10-16(22)5-7-17(14)29-2/h4-10H,11-12H2,1-3H3,(H,23,25) |
| InChIKey | MGGXXQAITDMPCU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.93 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|