C13H16N2O5S — CID 151664784
1-(2-methoxy-5-methylphenyl)sulfonyl-1,4-diazepane-2,5-dione (PubChem CID 151664784) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)sulfonyl-1,4-diazepane-2,5-dione.
| Compound Name | 1-(2-methoxy-5-methylphenyl)sulfonyl-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 151664784 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)sulfonyl-1,4-diazepane-2,5-dione |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N1CCC(=O)NCC1=O |
| InChI | InChI=1S/C13H16N2O5S/c1-9-3-4-10(20-2)11(7-9)21(18,19)15-6-5-12(16)14-8-13(15)17/h3-4,7H,5-6,8H2,1-2H3,(H,14,16) |
| InChIKey | QXHBGESEOSEIOM-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |