C12H14N2O5S — CID 66085376
4-(2-methoxy-5-methylphenyl)sulfonylpiperazine-2,6-dione (PubChem CID 66085376) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is 4-(2-methoxy-5-methylphenyl)sulfonylpiperazine-2,6-dione.
| Compound Name | 4-(2-methoxy-5-methylphenyl)sulfonylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66085376 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4-(2-methoxy-5-methylphenyl)sulfonylpiperazine-2,6-dione |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C12H14N2O5S/c1-8-3-4-9(19-2)10(5-8)20(17,18)14-6-11(15)13-12(16)7-14/h3-5H,6-7H2,1-2H3,(H,13,15,16) |
| InChIKey | CHIFZNAUXKFQSL-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|