C11H13F2NO3S — CID 167493621
3,3-difluoro-1-(2-methoxy-5-methylphenyl)sulfonylazetidine (PubChem CID 167493621) has the molecular formula C11H13F2NO3S and a molecular weight of 277.29 g/mol. Its IUPAC name is 3,3-difluoro-1-(2-methoxy-5-methylphenyl)sulfonylazetidine.
| Compound Name | 3,3-difluoro-1-(2-methoxy-5-methylphenyl)sulfonylazetidine |
|---|---|
| PubChem CID | 167493621 |
| Molecular Formula | C11H13F2NO3S |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 3,3-difluoro-1-(2-methoxy-5-methylphenyl)sulfonylazetidine |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N1CC(F)(F)C1 |
| InChI | InChI=1S/C11H13F2NO3S/c1-8-3-4-9(17-2)10(5-8)18(15,16)14-6-11(12,13)7-14/h3-5H,6-7H2,1-2H3 |
| InChIKey | GKGUVRRPLRJNGJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |