C19H17ClN2O5S — CID 66934856
4-(4-chlorophenyl)sulfonyl-6-[(2-hydroxy-5-methylphenyl)methylidene]-1,4-diazepane-2,5-dione (PubChem CID 66934856) has the molecular formula C19H17ClN2O5S and a molecular weight of 420.87 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfonyl-6-[(2-hydroxy-5-methylphenyl)methylidene]-1,4-diazepane-2,5-dione.
| Compound Name | 4-(4-chlorophenyl)sulfonyl-6-[(2-hydroxy-5-methylphenyl)methylidene]-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 66934856 |
| Molecular Formula | C19H17ClN2O5S |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 4-(4-chlorophenyl)sulfonyl-6-[(2-hydroxy-5-methylphenyl)methylidene]-1,4-diazepane-2,5-dione |
| SMILES | Cc1ccc(O)c(C=C2CNC(=O)CN(S(=O)(=O)c3ccc(Cl)cc3)C2=O)c1 |
| InChI | InChI=1S/C19H17ClN2O5S/c1-12-2-7-17(23)13(8-12)9-14-10-21-18(24)11-22(19(14)25)28(26,27)16-5-3-15(20)4-6-16/h2-9,23H,10-11H2,1H3,(H,21,24) |
| InChIKey | JHWHBZFNQQIPKE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|