C20H17ClN2O8S — CID 76588798
2-chloro-5-[[6-[(5-hydroxy-2-methoxyphenyl)methylidene]-3,7-dioxo-1,4-diazepan-1-yl]sulfonyl]benzoic acid (PubChem CID 76588798) has the molecular formula C20H17ClN2O8S and a molecular weight of 480.88 g/mol. Its IUPAC name is 2-chloro-5-[[6-[(5-hydroxy-2-methoxyphenyl)methylidene]-3,7-dioxo-1,4-diazepan-1-yl]sulfonyl]benzoic acid.
| Compound Name | 2-chloro-5-[[6-[(5-hydroxy-2-methoxyphenyl)methylidene]-3,7-dioxo-1,4-diazepan-1-yl]sulfonyl]benzoic acid |
|---|---|
| PubChem CID | 76588798 |
| Molecular Formula | C20H17ClN2O8S |
| Molecular Weight | 480.88 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | 2-chloro-5-[[6-[(5-hydroxy-2-methoxyphenyl)methylidene]-3,7-dioxo-1,4-diazepan-1-yl]sulfonyl]benzoic acid |
| SMILES | COc1ccc(O)cc1C=C1CNC(=O)CN(S(=O)(=O)c2ccc(Cl)c(C(=O)O)c2)C1=O |
| InChI | InChI=1S/C20H17ClN2O8S/c1-31-17-5-2-13(24)7-11(17)6-12-9-22-18(25)10-23(19(12)26)32(29,30)14-3-4-16(21)15(8-14)20(27)28/h2-8,24H,9-10H2,1H3,(H,22,25)(H,27,28) |
| InChIKey | WOQREMPWZLDLPO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.88 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|